Cyanidin-3,5-O-diglucoside chloride structure
|
Common Name | Cyanidin-3,5-O-diglucoside chloride | ||
|---|---|---|---|---|
| CAS Number | 2611-67-8 | Molecular Weight | 646.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31ClO16 | Melting Point | 203-204ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Cyanidin-3,5-O-diglucoside chlorideCyanidin 3,5-diglucoside chloride is a type of anthocyanin. Cyanidin 3,5-diglucoside chloride inhibits hyperbaric pressure-induced GLAST decrease. Cyanidin 3,5-diglucoside chloride has the potential for the research of glaucoma[1]. |
| Name | cyanin chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Cyanidin 3,5-diglucoside chloride is a type of anthocyanin. Cyanidin 3,5-diglucoside chloride inhibits hyperbaric pressure-induced GLAST decrease. Cyanidin 3,5-diglucoside chloride has the potential for the research of glaucoma[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 203-204ºC |
|---|---|
| Molecular Formula | C27H31ClO16 |
| Molecular Weight | 646.98 |
| Exact Mass | 646.13000 |
| PSA | 272.59000 |
| InChIKey | QDVZZZBBPRFPDG-DHJOXOLYSA-N |
| SMILES | OCC1OC(Oc2cc3c(OC4OC(CO)C(O)C(O)C4O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)C1O.[Cl-] |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Methylation mediated by an anthocyanin, O-methyltransferase, is involved in purple flower coloration in Paeonia.
J. Exp. Bot. 66 , 6563-77, (2015) Anthocyanins are major pigments in plants. Methylation plays a role in the diversity and stability of anthocyanins. However, the contribution of anthocyanin methylation to flower coloration is still u... |
| CYANIN CHLORIDE |
| cyanidin 3,5-diglucoside chloride chloride |
| cyanidin-3,5-di-O-G |
| Cianidin-3,5-diglucoside |
| Cyanidol 3,5-diglucoside chloride |
| Cyanidin-3,5-di-O-glucoside |
| CyaninChloride |