clonitrate structure
|
Common Name | clonitrate | ||
|---|---|---|---|---|
| CAS Number | 2612-33-1 | Molecular Weight | 200.535 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 250.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C3H5ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.6±21.8 °C | |
| Name | (1-chloro-3-nitrooxypropan-2-yl) nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 250.9±20.0 °C at 760 mmHg |
| Molecular Formula | C3H5ClN2O6 |
| Molecular Weight | 200.535 |
| Flash Point | 105.6±21.8 °C |
| Exact Mass | 199.983612 |
| PSA | 110.10000 |
| LogP | 1.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | SUAJWTBTMNHVBZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCC(CCl)O[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~85%
clonitrate CAS#:2612-33-1 |
| Literature: Golding, Peter; Millar, Ross W.; Paul, Norman C.; Richards, David H. Tetrahedron, 1993 , vol. 49, # 32 p. 7037 - 7050 |
|
~%
clonitrate CAS#:2612-33-1 |
| Literature: Golding, Peter; Millar, Ross W.; Paul, Norman C.; Richards, David H. Tetrahedron, 1993 , vol. 49, # 32 p. 7037 - 7050 |
|
~%
clonitrate CAS#:2612-33-1 |
| Literature: Henry Justus Liebigs Annalen der Chemie, 1870 , vol. 155, p. 166 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Clonitrate (USAN/INN) |
| 3-chloropropane-1,2-diol dinitrate |
| 1,2-Propanediol, 3-chloro-, dinitrate |
| UNII:MIG1YFL8MD |
| UNII-MIG1YFL8MD |
| clonitrate |
| Dinitrochlorhydrin |
| 3-Chlor-1,2-di(nitryloxy)propan |
| 1-Chlor-2,3-bis-nitryloxy-propan |
| Clonitrato |
| 1-chloro-2,3-bis-nitrooxy-propane |
| Clonitratum |
| 3-Chloropropane-1,2-diyl dinitrate |
| 3-Chloro-1,2-propanediyl dinitrate |
| Salpetersaeure-(3-chlor-propylenester) |
| 1-chloro-2,3-bis-nitryloxy-propane |
| 3-Chlor-propylenglykol-dinitrat |