difluoro-bis(trifluorosilyloxy)silane structure
|
Common Name | difluoro-bis(trifluorosilyloxy)silane | ||
|---|---|---|---|---|
| CAS Number | 26121-10-8 | Molecular Weight | 268.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | F8O2Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | difluoro-bis(trifluorosilyloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | F8O2Si3 |
|---|---|
| Molecular Weight | 268.24300 |
| Exact Mass | 267.90800 |
| PSA | 18.46000 |
| LogP | 2.08240 |
| InChIKey | KODJEXIZUNNAIE-UHFFFAOYSA-N |
| SMILES | F[Si](F)(F)O[Si](F)(F)O[Si](F)(F)F |
|
~%
difluoro-bis(tr... CAS#:26121-10-8 |
| Literature: Booth, H. S.; Osten, R. A. Journal of the American Chemical Society, 1945 , vol. 67, p. 1092 - 1096 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Octafluortrisiloxan |
| octafluoro trisiloxane |
| Trisiloxane,octafluoro |