ethoxy-[4-[ethoxy(dimethyl)silyl]phenyl]-dimethylsilane structure
|
Common Name | ethoxy-[4-[ethoxy(dimethyl)silyl]phenyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 2615-23-8 | Molecular Weight | 282.52600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethoxy-[4-[ethoxy(dimethyl)silyl]phenyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26O2Si2 |
|---|---|
| Molecular Weight | 282.52600 |
| Exact Mass | 282.14700 |
| PSA | 18.46000 |
| LogP | 2.58380 |
| InChIKey | UHJWZLRWUMOYIJ-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(C)c1ccc([Si](C)(C)OCC)cc1 |
|
~63%
ethoxy-[4-[etho... CAS#:2615-23-8 |
| Literature: Mao, Shane S. H.; Liu, Feng-Quan; Tilley, T. Don Journal of the American Chemical Society, 1998 , vol. 120, # 6 p. 1193 - 1206 |
|
~%
ethoxy-[4-[etho... CAS#:2615-23-8 |
| Literature: Breed,L.W.; Elliott,R.L. Journal of Organometallic Chemistry, 1967 , vol. 9, p. 188 - 192 |
|
~%
ethoxy-[4-[etho... CAS#:2615-23-8 |
| Literature: Westinghouse Electric Corp. Patent: US2883395 , 1956 ; |
| Si,Si'-Diaethoxy-Si,Si,Si',Si'-tetramethyl-Si,Si'-p-phenylen-bis-silan |
| 1,4-Bis-(aethoxy-dimethyl-silyl)-benzol |
| 1,4-bis(ethoxydimethylsilyl)benzene |
| Si,Si'-diethoxy-Si,Si,Si',Si'-tetramethyl-Si,Si'-p-phenylene-bis-silane |
| Silane,1,4-phenylenebis[ethoxydimethyl |