3-Chloro-4-(trifluoromethoxy)benzoyl chloride structure
|
Common Name | 3-Chloro-4-(trifluoromethoxy)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 261763-17-1 | Molecular Weight | 259.00900 | |
| Density | 1.54g/cm3 | Boiling Point | 248.5ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.7ºC | |
| Name | 3-Chloro-4-(trifluoromethoxy)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 248.5ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2F3O2 |
| Molecular Weight | 259.00900 |
| Flash Point | 99.7ºC |
| Exact Mass | 257.94600 |
| PSA | 26.30000 |
| LogP | 3.61760 |
| Vapour Pressure | 0.0242mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | BAFYBTOKEKLGKH-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(OC(F)(F)F)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| pc0179 |