5,5'-((1,1'-Biphenyl)-4,4'-diylbis(oxy))bis-1,3-isobenzofurandione structure
|
Common Name | 5,5'-((1,1'-Biphenyl)-4,4'-diylbis(oxy))bis-1,3-isobenzofurandione | ||
|---|---|---|---|---|
| CAS Number | 26177-82-2 | Molecular Weight | 478.40600 | |
| Density | 1.485g/cm3 | Boiling Point | 708.5ºC at 760mmHg | |
| Molecular Formula | C28H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.5ºC | |
| Name | 5-[4-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 708.5ºC at 760mmHg |
| Molecular Formula | C28H14O8 |
| Molecular Weight | 478.40600 |
| Flash Point | 304.5ºC |
| Exact Mass | 478.06900 |
| PSA | 105.20000 |
| LogP | 5.55940 |
| Vapour Pressure | 6.35E-20mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | XPPLXZKTJFEVNS-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(Oc3ccc(-c4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)cc3)ccc21 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Isobenzofurandione,5,5'-[[1,1'-biphenyl]-4,4'-diylbis(oxy)]bis |
| 4,4'-(4,4'-Diphenylendioxy)diphthalsaeureanhydrid |
| 5,5'-[biphenyl-4,4'-diylbis(oxy)]bis(2-benzofuran-1,3-dione) |
| 5,5'-[[1,1'-biphenyl]-4,4'-diylbis(oxy)]bis-1,3-isobenzofurandione |