4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzoic acid structure
|
Common Name | 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 26192-76-7 | Molecular Weight | 300.74000 | |
| Density | 1.34g/cm3 | Boiling Point | 490.8ºC at 760mmHg | |
| Molecular Formula | C16H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 490.8ºC at 760mmHg |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.74000 |
| Flash Point | 250.6ºC |
| Exact Mass | 300.06700 |
| PSA | 52.90000 |
| LogP | 3.15320 |
| Vapour Pressure | 1.89E-10mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | NNPXVOKLLUQZCH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 247-513-8 |
| 4-[3-(4-CHLOROPHENYL)-4,5-DIHYDRO-1H-PYRAZOL-1-YL]BENZOIC ACID |
| 4-[3-(4-chloro-phenyl)-4,5-dihydro-pyrazol-1-yl]-benzoic acid |
| Benzoic acid,4-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-1-yl] |