4-Methyl-3-(trifluoromethyl)benzoyl chloride structure
|
Common Name | 4-Methyl-3-(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 261952-11-8 | Molecular Weight | 222.59200 | |
| Density | 1.343g/cm3 | Boiling Point | 230.2ºC at 760 mmHg | |
| Molecular Formula | C9H6ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93ºC | |
| Name | 4-Methyl-3-(trifluoromethyl)benzoyl chloride |
|---|
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 230.2ºC at 760 mmHg |
| Molecular Formula | C9H6ClF3O |
| Molecular Weight | 222.59200 |
| Flash Point | 93ºC |
| Exact Mass | 222.00600 |
| PSA | 17.07000 |
| LogP | 3.39280 |
| Vapour Pressure | 0.0666mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | KKGAVDJJVMSTSV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)Cl)cc1C(F)(F)F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |