2-Amino-2-(3, 4, 5-trifluorophenyl)acetic acid structure
|
Common Name | 2-Amino-2-(3, 4, 5-trifluorophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 261952-27-6 | Molecular Weight | 205.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-2-(3,4,5-trifluorophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6F3NO2 |
|---|---|
| Molecular Weight | 205.13400 |
| Exact Mass | 205.03500 |
| PSA | 63.32000 |
| LogP | 1.88860 |
| InChIKey | SKPOIZISALNBFF-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1cc(F)c(F)c(F)c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3,4,5-Trifluoro-DL-phenylglycine |
| 3,4,5-trifluorophenylglycine |