1H-Benzimidazole,2-(4-methoxyphenyl)- structure
|
Common Name | 1H-Benzimidazole,2-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2620-81-7 | Molecular Weight | 224.25800 | |
| Density | 1.216g/cm3 | Boiling Point | 428.2ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | 2-(4-methoxyphenyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 428.2ºC at 760 mmHg |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.25800 |
| Flash Point | 154.4ºC |
| Exact Mass | 224.09500 |
| PSA | 37.91000 |
| LogP | 3.23850 |
| Vapour Pressure | 1.55E-07mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | PYRWEZBEXFMUHH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F0852-0174 |
| 1-benzimidazol-2-yl-4-methoxybenzene |