2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate structure
|
Common Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 26222-42-4 | Molecular Weight | 257.32600 | |
| Density | N/A | Boiling Point | 187ºC at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.6ºC | |
| Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 187ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.32600 |
| Flash Point | 70.6ºC |
| Exact Mass | 257.16300 |
| PSA | 55.84000 |
| LogP | 1.40280 |
| Vapour Pressure | 0.644mmHg at 25°C |
| InChIKey | LIMHZMBWISMZJA-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCN(C)C |
| 2-Methyl-2-propenoic acid,2-(dimethylamino)ethyl ester,polymer with 2-methyl-2-propenoic acid,methyl ester |
| 2-Propenoic acid,2-methyl-,2-(dimethylamino)ethyl ester,polymer with methyl 2-methyl-2-propenoate |