3-(4-Allyloxy-3-methoxyphenyl)-2-propenehydroxamic acid structure
|
Common Name | 3-(4-Allyloxy-3-methoxyphenyl)-2-propenehydroxamic acid | ||
|---|---|---|---|---|
| CAS Number | 26228-04-6 | Molecular Weight | 249.26200 | |
| Density | 1.187g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-hydroxy-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Exact Mass | 249.10000 |
| PSA | 71.28000 |
| LogP | 2.61890 |
| Index of Refraction | 1.577 |
| InChIKey | CQMSOKCEWXQWON-FNORWQNLSA-N |
| SMILES | C=CCOc1ccc(C=CC(=O)NO)cc1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Propenamide,N-hydroxy-3-[3-methoxy-4-(2-propen-1-yloxy)phenyl] |
| 4-ALLYLOXY-3-METHOXYCINNAMOHYDROXAMIC ACID |
| Cinnamohydroxamicacid,4-(allyloxy)-3-methoxy-(8CI) |