4-BROMO-2-METHOXY-N-BOC-ANILINE structure
|
Common Name | 4-BROMO-2-METHOXY-N-BOC-ANILINE | ||
|---|---|---|---|---|
| CAS Number | 262433-01-2 | Molecular Weight | 302.16400 | |
| Density | 1.382g/cm3 | Boiling Point | 313.5ºC at 760mmHg | |
| Molecular Formula | C12H16BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | tert-butyl N-(4-bromo-2-methoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760mmHg |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.16400 |
| Flash Point | 143.4ºC |
| Exact Mass | 301.03100 |
| PSA | 47.56000 |
| LogP | 3.87770 |
| Vapour Pressure | 0.000496mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | LFWHJZGNFWTUIO-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)ccc1NC(=O)OC(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Bromo-2-methoxy-N-Boc-aniline |
| N-t-Boc-4-bromo-2-methoxyaniline |
| tert-butyl 4-bromo-2-methoxyphenylcarbamate |