N-(2,5-dimethoxyphenyl)-4-methylbenzamide structure
|
Common Name | N-(2,5-dimethoxyphenyl)-4-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 262436-41-9 | Molecular Weight | 285.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[5-Methoxy-2-(methoxymethyl)phenyl]-4-methylbenzamide |
|---|
| Molecular Formula | C17H19NO3 |
|---|---|
| Molecular Weight | 285.33800 |
| Exact Mass | 285.13600 |
| PSA | 47.56000 |
| LogP | 3.47530 |
| InChIKey | ALQVEQHAEAYEIF-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(C)cc2)c1 |
|
~65%
N-(2,5-dimethox... CAS#:262436-41-9 |
| Literature: Jackson, Yvette A.; Lyon, Michael A.; Townsend, Norman; Bellabe, Kettyna; Soltanik, Fernando Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 2 p. 205 - 210 |
|
~%
N-(2,5-dimethox... CAS#:262436-41-9 |
| Literature: Jackson, Yvette A.; Lyon, Michael A.; Townsend, Norman; Bellabe, Kettyna; Soltanik, Fernando Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 2 p. 205 - 210 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |