2-(Benzofuran-3-yl)ethyl 4-methylbenzenesulfonate structure
|
Common Name | 2-(Benzofuran-3-yl)ethyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 26278-25-1 | Molecular Weight | 316.37200 | |
| Density | 1.275g/cm3 | Boiling Point | 480.6ºC at 760 mmHg | |
| Molecular Formula | C17H16O4S | Melting Point | 61ºC | |
| MSDS | N/A | Flash Point | 244.5ºC | |
| Name | 2-(1-benzofuran-3-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 480.6ºC at 760 mmHg |
| Melting Point | 61ºC |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.37200 |
| Flash Point | 244.5ºC |
| Exact Mass | 316.07700 |
| PSA | 64.89000 |
| LogP | 4.77000 |
| Vapour Pressure | 6.22E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | OEJOFPWUQPRTDR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2coc3ccccc23)cc1 |
| HS Code | 2932999099 |
|---|
|
~71%
2-(Benzofuran-3... CAS#:26278-25-1 |
| Literature: Paul, Sibasish; Pattanayak, Sankha; Sinha, Surajit Tetrahedron Letters, 2011 , vol. 52, # 46 p. 6166 - 6169 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzo[b]furanethanol tosylate |
| 2-(benzofuran-3-yl)ethy 4-methylbenzenesulfonate |
| 3-benzofuranethanol |
| Y8494 |