2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] structure
|
Common Name | 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] | ||
|---|---|---|---|---|
| CAS Number | 263159-67-7 | Molecular Weight | 440.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34B2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H34B2O6 |
|---|---|
| Molecular Weight | 440.1 |
| InChIKey | XGOVEFNQASZESK-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(OC)c(B3OC(C)(C)C(C)(C)O3)cc2cc1B1OC(C)(C)C(C)(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: CAS number of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is 263159-67-7. |
| Q: What is the InChIKey of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: InChIKey of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is XGOVEFNQASZESK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: SMILES notation of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is COc1cc2cc(OC)c(B3OC(C)(C)C(C)(C)O3)cc2cc1B1OC(C)(C)C(C)(C)O1. |
| Q: What is the molecular weight of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: Molecular weight of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is 440.1. |
| Q: What is the molecular formula of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: Molecular formula of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is C24H34B2O6. |
| Q: What is the English name of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]? |
| A: The English name of 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane] is 2,2a(2)-(3,6-Dimethoxy-2,7-naphthalenediyl)bis[4,4,5,5-tetramethyl-1,3,2-dioxaborolane]. |
| Q: What is the Chinese name of 263159-67-7? |
| A: Chinese name of 263159-67-7 is 263159-67-7. |