benzyl 3-hydroxy-4-phenylmethoxybenzoate
Modify Date: 2025-12-01 14:42:40
benzyl 3-hydroxy-4-phenylmethoxybenzoate structure
|
Common Name | benzyl 3-hydroxy-4-phenylmethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 263277-12-9 | Molecular Weight | 334.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 3-hydroxy-4-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H18O4 |
|---|---|
| Molecular Weight | 334.36500 |
| Exact Mass | 334.12100 |
| PSA | 55.76000 |
| LogP | 4.32820 |
| InChIKey | VJEWLMHAPKBHFM-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)c1ccc(OCc2ccccc2)c(O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzyl 4-(benzyloxy)-3-hydroxybenzoate |