N,N-Dimethyl-2-{4-[(E)-3-(3,4,5-trimethoxy-phenyl)-acryloyl]-piperazin-1-yl}-acetamide; compound with (Z)-but-2-enedioic acid structure
|
Common Name | N,N-Dimethyl-2-{4-[(E)-3-(3,4,5-trimethoxy-phenyl)-acryloyl]-piperazin-1-yl}-acetamide; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 26328-02-9 | Molecular Weight | 507.53400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H33N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-Dimethyl-2-{4-[(E)-3-(3,4,5-trimethoxy-phenyl)-acryloyl]-piperazin-1-yl}-acetamide; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C24H33N3O9 |
|---|---|
| Molecular Weight | 507.53400 |
| Exact Mass | 507.22200 |
| PSA | 146.15000 |
| LogP | 0.54560 |
| InChIKey | LJCASFAEMHVNTC-GVTSEVKNSA-N |
| SMILES | COc1cc(C=CC(=O)N2CCN(CC(=O)N(C)C)CC2)cc(OC)c1OC.O=C(O)C=CC(=O)O |