butane-1,4-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene,oxepan-2-one structure
|
Common Name | butane-1,4-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene,oxepan-2-one | ||
|---|---|---|---|---|
| CAS Number | 26354-06-3 | Molecular Weight | 454.51600 | |
| Density | N/A | Boiling Point | 373.4ºC at 760mmHg | |
| Molecular Formula | C25H30N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154ºC | |
| Name | butane-1,4-diol,1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene,oxepan-2-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 373.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.51600 |
| Flash Point | 154ºC |
| Exact Mass | 454.21000 |
| PSA | 125.62000 |
| LogP | 4.06680 |
| Vapour Pressure | 9.02E-06mmHg at 25°C |
| InChIKey | CLLSFEKDRQKTKP-UHFFFAOYSA-N |
| SMILES | O=C1CCCCCO1.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1.OCCCCO |
| 2-oxepanone,polymer with 1,4-butanediol and 1,1A'A inverted exclamation markA'A-methylenebis[4-isocyanatobenz |
| 2-Oxepanone,polymer with 1,4-butanediol and 1,1'-methylenebis(4-isocyanatobenzene) |