4-Bromo-3,5-dimethoxybenzohydrazide
Modify Date: 2025-10-01 13:35:56
4-Bromo-3,5-dimethoxybenzohydrazide structure
|
Common Name | 4-Bromo-3,5-dimethoxybenzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 263567-38-0 | Molecular Weight | 275.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromo-3,5-dimethoxybenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11BrN2O3 |
|---|---|
| Molecular Weight | 275.09900 |
| Exact Mass | 273.99500 |
| PSA | 77.07000 |
| LogP | 2.34490 |
| InChIKey | FOUWHKNTQJDOLX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NN)cc(OC)c1Br |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-bromo-3,5-dimethoxybenzoylhydrazine |