methyl 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)acetate structure
|
Common Name | methyl 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 263570-28-1 | Molecular Weight | 265.305 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 377.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2±27.9 °C | |
| Name | methyl 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.7±42.0 °C at 760 mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.305 |
| Flash Point | 182.2±27.9 °C |
| Exact Mass | 265.131409 |
| PSA | 56.79000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | NVXHORURRXLOGZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1NCCc2cc(OC)c(OC)cc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl (6,7-dimethoxy-1,2,3,4-tetrahydro-1-isoquinolinyl)acetate |
| 1-Isoquinolineacetic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, methyl ester |
| methyl 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-1-acetate |
| Methyl (6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)acetate |