ETHYL 4,6-BIS(4-CHLOROPHENYL)-2-OXO-3-CYCLOHEXENE-1-CARBOXYLATE
ETHYL 4,6-BIS(4-CHLOROPHENYL)-2-OXO-3-CYCLOHEXENE-1-CARBOXYLATE structure
|
Common Name | ETHYL 4,6-BIS(4-CHLOROPHENYL)-2-OXO-3-CYCLOHEXENE-1-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 26379-96-4 | Molecular Weight | 389.27200 | |
| Density | 1.294g/cm3 | Boiling Point | 490ºC at 760mmHg | |
| Molecular Formula | C21H18Cl2O3 | Melting Point | 124-126ºC | |
| MSDS | N/A | Flash Point | 173.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 490ºC at 760mmHg |
| Melting Point | 124-126ºC |
| Molecular Formula | C21H18Cl2O3 |
| Molecular Weight | 389.27200 |
| Flash Point | 173.2ºC |
| Exact Mass | 388.06300 |
| PSA | 43.37000 |
| LogP | 5.31270 |
| Vapour Pressure | 9.47E-10mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | VTXYDRYEGXEPOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccc(Cl)cc2)CC1c1ccc(Cl)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ETHYL 4,6-BIS(4... CAS#:26379-96-4 |
| Literature: Padmavathi; Sharmila; Balaiah; Somasekhar Reddy; Bhaskar Reddy Synthetic Communications, 2001 , vol. 31, # 14 p. 2119 - 2126 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5-Bis-5-(p-chlorphenyl)-4-carbaethoxy-cyclohexen-(3)-on |
| 6-carbethoxy-3,5-di(4-chlorophenyl)cyclohex-2-enone |
| ethylbischlorophenyloxocyclohexenecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: LogP of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is 5.31270. |
| Q: What is the molecular formula of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: Molecular formula of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is C21H18Cl2O3. |
| Q: What is the polar surface area (PSA) of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: Polar surface area (PSA) of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is 43.37000. |
| Q: What is the CAS number of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: CAS number of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is 26379-96-4. |
| Q: What is the InChIKey of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: InChIKey of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is VTXYDRYEGXEPOA-UHFFFAOYSA-N. |
| Q: What English synonyms does ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate have? |
| A: English synonyms of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate: 1,5-Bis-5-(p-chlorphenyl)-4-carbaethoxy-cyclohexen-(3)-on, 6-carbethoxy-3,5-di(4-chlorophenyl)cyclohex-2-enone, ethylbischlorophenyloxocyclohexenecarboxylate. |
| Q: What is the SMILES notation of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: SMILES notation of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is CCOC(=O)C1C(=O)C=C(c2ccc(Cl)cc2)CC1c1ccc(Cl)cc1. |
| Q: What is the melting point of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: Melting point of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is 124-126ºC. |
| Q: What is the English name of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: The English name of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate. |
| Q: What is the boiling point of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate? |
| A: Boiling point of ethyl 4,6-bis(4-chlorophenyl)-2-oxocyclohex-3-ene-1-carboxylate is 490ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |