(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid,4-methoxyphenol structure
|
Common Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid,4-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 263878-34-8 | Molecular Weight | 424.57200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid,4-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H36O4 |
|---|---|
| Molecular Weight | 424.57200 |
| Exact Mass | 424.26100 |
| PSA | 66.76000 |
| LogP | 7.00340 |
| InChIKey | VXWIYJTXZWNXJP-ABAXVIISSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)O.COc1ccc(O)cc1 |
| Retinoic acid,mixt. with 4-methoxyphenol |
| Mequinol and tretinoin |
| Solage |
| C20H28O2.C7H8O2 |
| MEQUINOL |
| Mequinol mixture with tretinoin |