2,5-dichloro-4-hydroxyphenoxyacetic acid structure
|
Common Name | 2,5-dichloro-4-hydroxyphenoxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2639-78-3 | Molecular Weight | 237.03700 | |
| Density | 1.613g/cm3 | Boiling Point | 397.4ºC at 760mmHg | |
| Molecular Formula | C8H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 2-(2,5-dichloro-4-hydroxyphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.613g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760mmHg |
| Molecular Formula | C8H6Cl2O4 |
| Molecular Weight | 237.03700 |
| Flash Point | 194.2ºC |
| Exact Mass | 235.96400 |
| PSA | 66.76000 |
| LogP | 2.16240 |
| Vapour Pressure | 4.97E-07mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | UENNJUJWZAJJIG-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc(Cl)c(O)cc1Cl |
|
~%
2,5-dichloro-4-... CAS#:2639-78-3 |
| Literature: Faulkner,J.K.; Woodcock,D. Journal of the Chemical Society, 1965 , p. 1187 - 1191 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (2,5-Dichlor-4-hydroxy-phenoxy)-essigsaeure |
| Acetic acid,(2,5-dichloro-4-hydroxyphenoxy) |
| 4-Hydroxy-2,5-dichloropphenoxyacetic acid |
| 2,5-Dichloro-4-hydroxyphenoxyacetic acid |
| 4-OH-2,5-D |
| 4-Hydroxy-2,5-dichlorphenoxyessigsaeure |