methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate
Modify Date: 2026-07-06 18:09:18
![methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate Structure](https://www.chemsrc.com/extcaspic/271/2639374-70-0.png)
methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate structure
|
Common Name | methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate | ||
|---|---|---|---|---|
| CAS Number | 2639374-70-0 | Molecular Weight | 284.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H28N2O3 |
|---|---|
| Molecular Weight | 284.39 |
| InChIKey | YEMDMMMQSRLPJT-FRRDWIJNSA-N |
| SMILES | COC(=O)CC(CNC(=O)C1CNCC1C)CC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: Molecular formula of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is C15H28N2O3. |
| Q: What is the SMILES notation of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: SMILES notation of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is COC(=O)CC(CNC(=O)C1CNCC1C)CC(C)C. |
| Q: What is the CAS number of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: CAS number of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is 2639374-70-0. |
| Q: What is the Chinese name of 2639374-70-0? |
| A: Chinese name of 2639374-70-0 is 2639374-70-0. |
| Q: What is the InChIKey of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: InChIKey of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is YEMDMMMQSRLPJT-FRRDWIJNSA-N. |
| Q: What is the molecular weight of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: Molecular weight of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is 284.39. |
| Q: What is the English name of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate? |
| A: The English name of methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate is methyl (3S)-5-methyl-3-({[(3RS,4RS)-4-methylpyrrolidin-3-yl]formamido}methyl)hexanoate. |