Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate
Modify Date: 2026-09-20 12:36:08
![Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate Structure](https://www.chemsrc.com/extcaspic/248/2639411-02-0.png)
Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate structure
|
Common Name | Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate | ||
|---|---|---|---|---|
| CAS Number | 2639411-02-0 | Molecular Weight | 249.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO3 |
|---|---|
| Molecular Weight | 249.30 |
| InChIKey | FIPBFGWHPPINSS-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCNCC(=O)c1ccc(C)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: InChIKey of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is FIPBFGWHPPINSS-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: CAS number of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is 2639411-02-0. |
| Q: What is the molecular weight of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: Molecular weight of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is 249.30. |
| Q: What is the SMILES notation of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: SMILES notation of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is COC(=O)CCCNCC(=O)c1ccc(C)cc1. |
| Q: What is the Chinese name of 2639411-02-0? |
| A: Chinese name of 2639411-02-0 is 2639411-02-0. |
| Q: What is the English name of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: The English name of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate. |
| Q: What is the molecular formula of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate? |
| A: Molecular formula of Methyl 4-{[2-(4-methylphenyl)-2-oxoethyl]amino}butanoate is C14H19NO3. |