2-Chloro-4,6-bis[(pentachlorophenyl)oxy]-1,3,5-triazine structure
|
Common Name | 2-Chloro-4,6-bis[(pentachlorophenyl)oxy]-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 26396-34-9 | Molecular Weight | 644.16200 | |
| Density | 1.884g/cm3 | Boiling Point | 712.3ºC at 760mmHg | |
| Molecular Formula | C15Cl11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.6ºC | |
| Name | 2-chloro-4,6-bis(2,3,4,5,6-pentachlorophenoxy)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.884g/cm3 |
|---|---|
| Boiling Point | 712.3ºC at 760mmHg |
| Molecular Formula | C15Cl11N3O2 |
| Molecular Weight | 644.16200 |
| Flash Point | 384.6ºC |
| Exact Mass | 638.65600 |
| PSA | 57.13000 |
| LogP | 10.64360 |
| Vapour Pressure | 2.6E-19mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | AYCYRPHLXAYENC-UHFFFAOYSA-N |
| SMILES | Clc1nc(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)nc(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| chloro-bis-pentachlorophenoxy-[1,3,5]triazine |
| 4,6-Bis(pentachlorophenoxy)-2-chloro-s-triazine |
| 2-chloro-4,6-bis(pentachlorophenoxy)-1,3,5-triazine |
| Chlor-bis-pentachlorphenoxy-[1,3,5]triazin |
| 2-Chloro-4,6-di(pentachlorophenoxy)-2-triazine |
| s-Triazine,4,6-bis(pentachlorophenoxy)-2-chloro |