2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine
Modify Date: 2026-09-27 13:49:02
![2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine Structure](https://www.chemsrc.com/extcaspic/354/2640976-73-2.png)
2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine structure
|
Common Name | 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine | ||
|---|---|---|---|---|
| CAS Number | 2640976-73-2 | Molecular Weight | 367.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21N3O2S |
|---|---|
| Molecular Weight | 367.5 |
| InChIKey | HPLZHYHWQURHNJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(c3ccc4cccnc4n3)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: Molecular weight of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is 367.5. |
| Q: What is the CAS number of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: CAS number of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is 2640976-73-2. |
| Q: What is the InChIKey of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: InChIKey of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is HPLZHYHWQURHNJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2640976-73-2? |
| A: Chinese name of 2640976-73-2 is 2640976-73-2. |
| Q: What is the molecular formula of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: Molecular formula of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is C20H21N3O2S. |
| Q: What is the English name of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: The English name of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine. |
| Q: What is the SMILES notation of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine? |
| A: SMILES notation of 2-[1-(4-Methanesulfonylphenyl)piperidin-4-yl]-1,8-naphthyridine is CS(=O)(=O)c1ccc(N2CCC(c3ccc4cccnc4n3)CC2)cc1. |