Naphtho[2,3-c]furan-1(3H)-one,4-(3,4-dihydroxyphenyl)-3a,4,9,9a-tetrahydro-6,7-dihydroxy-, (3aR,4S,9aS)- structure
|
Common Name | Naphtho[2,3-c]furan-1(3H)-one,4-(3,4-dihydroxyphenyl)-3a,4,9,9a-tetrahydro-6,7-dihydroxy-, (3aR,4S,9aS)- | ||
|---|---|---|---|---|
| CAS Number | 2643-01-8 | Molecular Weight | 328.31600 | |
| Density | 1.52g/cm3 | Boiling Point | 665.7ºC at 760mmHg | |
| Molecular Formula | C18H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.5ºC | |
| Name | 4-(3,4-dihydroxyphenyl)-6,7-dihydroxy-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-1-one |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 665.7ºC at 760mmHg |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.31600 |
| Flash Point | 249.5ºC |
| Exact Mass | 328.09500 |
| PSA | 107.22000 |
| LogP | 1.98620 |
| InChIKey | WQECJMDOMUSXDX-UHFFFAOYSA-N |
| SMILES | O=C1OCC2C1Cc1cc(O)c(O)cc1C2c1ccc(O)c(O)c1 |
|
~%
Naphtho[2,3-c]f... CAS#:2643-01-8 |
| Literature: Hearon et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4005 |
|
~%
Naphtho[2,3-c]f... CAS#:2643-01-8 |
| Literature: Hearon et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4005 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |