Z-Gly-Pro-Leu-Gly-Pro-OH structure
|
Common Name | Z-Gly-Pro-Leu-Gly-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 2646-61-9 | Molecular Weight | 573.63800 | |
| Density | 1.3g/cm3 | Boiling Point | 930.6ºC at 760mmHg | |
| Molecular Formula | C28H39N5O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 516.6ºC | |
| Name | z-gly-pro-leu-gly-pro-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 930.6ºC at 760mmHg |
| Molecular Formula | C28H39N5O8 |
| Molecular Weight | 573.63800 |
| Flash Point | 516.6ºC |
| Exact Mass | 573.28000 |
| PSA | 174.45000 |
| LogP | 1.67500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | DGRDYZZPQWDRBB-FKBYEOEOSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCCN1C(=O)CNC(=O)OCc1ccccc1)C(=O)NCC(=O)N1CCCC1C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
New fluorogenic substrates for alpha-thrombin, factor Xa, kallikreins, and urokinase.
J. Biochem. Tokyo 82 , 1495, (1977) Twenty peptide-4-methylcoumarin amides (MCA) were newly synthesized and tested as possible substrates for alpha-thrombin, factor Xa, kallikreins, urokinase, and plasmin. These fluorogenic peptides con... |
|
|
The specificity of sea urchin hatching enzyme (envelysin) places it in the mammalian matrix metalloproteinase family.
Biochemistry 30(25) , 6115-23, (1991) The sea urchin hatching enzyme (HEz) is a protease capable of dissolving the fertilization envelope that surrounds the embryo as a protective coat during early development. We have now purified a 37-k... |
|
|
Simultaneous analyses of clostridium collagenase and neutral proteinase activities with a single synthetic substrate.
Anal. Biochem. 107(1) , 96-102, (1980) Two simple methods are presented for simultaneously detecting the activities of both Clostridium histolyticum collagenase and a neutral proteinase that contaminates commercial preparations of collagen... |
| carbobenzoxyglycyl-prolyl-leucyl-glycyl-proline |
| N-CARBOBENZOXY-GLYCYL-PROPYL-L-LEUCYLGLYCYL-L-PROLINE |
| N-carbobenzyloxy-Gly-Pro-Leu-Gly-Pro |
| N-CBZ-GLY-PRO-LEU-GLY-PRO |
| CBZ-GLY-L-PRO-LEU-GLY-PRO |
| z-gly-pro-leu-gly-pro |
| Z-GLYCYL-L-PROLYL-L-LEUCYL-GLYCYL-L-PROLINE |