1-Cyclobutene-1-carbonyl fluoride, 2-methyl-4-(trifluoromethyl)- (6CI,8CI) structure
|
Common Name | 1-Cyclobutene-1-carbonyl fluoride, 2-methyl-4-(trifluoromethyl)- (6CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 2647-09-8 | Molecular Weight | 182.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-(trifluoromethyl)cyclobutene-1-carbonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6F4O |
|---|---|
| Molecular Weight | 182.11600 |
| Exact Mass | 182.03500 |
| PSA | 17.07000 |
| LogP | 2.38120 |
| InChIKey | MMZBORUROZFWME-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)F)C(C(F)(F)F)C1 |
|
~%
1-Cyclobutene-1... CAS#:2647-09-8 |
| Literature: Hasek,W.R. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 543 - 551 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Cyclobutene-1-carbonyl fluoride,2-methyl-4-(trifluoromethyl)-(6CI,8CI) |
| 1-Methyl-2-fluorformyl-3-trifluormethyl-cyclobuten-1 |
| 1-Cyclobutene-1-carbonylfluoride,2-methyl-4-(trifluoromethyl) |