methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate
methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate structure
|
Common Name | methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate | ||
|---|---|---|---|---|
| CAS Number | 26480-86-4 | Molecular Weight | 460.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18IO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H18IO2P |
|---|---|
| Molecular Weight | 460.24500 |
| Exact Mass | 460.00900 |
| PSA | 36.11000 |
| LogP | 3.71840 |
| InChIKey | IMCYSLFNFQFTDW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(I)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl 2-iodo-2... CAS#:26480-86-4 |
| Literature: Maerkl,G. Chemische Berichte, 1961 , vol. 94, p. 2996 - 3004 |
|
~%
methyl 2-iodo-2... CAS#:26480-86-4 |
| Literature: Maerkl,G. Chemische Berichte, 1961 , vol. 94, p. 2996 - 3004 |
|
~%
methyl 2-iodo-2... CAS#:26480-86-4 |
| Literature: Maerkl,G. Chemische Berichte, 1961 , vol. 94, p. 2996 - 3004 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ph3P=CI(CO2Me) |
| 2-Iod-2-triphenylphosphoranyliden-essigsaeure-methylester |
| Acetic acid,iodo(triphenylphosphoranylidene)-,methyl ester |
| methyl 2-iodo-2-(triphenylphosphoranylidene)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: Related upstream materials(CAS) of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate: 13504-77-3;1779-58-4. |
| Q: What is the CAS number of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: CAS number of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is 26480-86-4. |
| Q: What is the Chinese name of 26480-86-4? |
| A: Chinese name of 26480-86-4 is 26480-86-4. |
| Q: What is the molecular weight of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: Molecular weight of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is 460.24500. |
| Q: What is the polar surface area (PSA) of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: Polar surface area (PSA) of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is 36.11000. |
| Q: What is the molecular formula of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: Molecular formula of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is C21H18IO2P. |
| Q: What is the InChIKey of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: InChIKey of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is IMCYSLFNFQFTDW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: SMILES notation of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is COC(=O)C(I)=P(c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the English name of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: The English name of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate. |
| Q: What is the LogP of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate? |
| A: LogP of methyl 2-iodo-2-(triphenyl-λ5-phosphanylidene)acetate is 3.71840. |