2,3',4'-TRICHLOROBENZOPHENONE structure
|
Common Name | 2,3',4'-TRICHLOROBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 264870-83-9 | Molecular Weight | 285.55300 | |
| Density | 1.403g/cm3 | Boiling Point | 409.3ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | (2-chlorophenyl)-(3,4-dichlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 409.3ºC at 760 mmHg |
| Molecular Formula | C13H7Cl3O |
| Molecular Weight | 285.55300 |
| Flash Point | 173ºC |
| Exact Mass | 283.95600 |
| PSA | 17.07000 |
| LogP | 4.87780 |
| Vapour Pressure | 6.54E-07mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | ABPKNSNXDDOSIW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)c1ccccc1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2-dimethylbutyric acid |
| 2,3',4'-trichlorobenzophenone |