(2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid
Modify Date: 2026-07-16 14:05:35
![(2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/244/2648901-65-7.png)
(2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid structure
|
Common Name | (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2648901-65-7 | Molecular Weight | 273.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO5 |
|---|---|
| Molecular Weight | 273.33 |
| InChIKey | YKLNULGKYIWMBK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(OC(C)(C)C)C1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: CAS number of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is 2648901-65-7. |
| Q: What is the English name of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: The English name of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid. |
| Q: What is the Chinese name of 2648901-65-7? |
| A: Chinese name of 2648901-65-7 is 2648901-65-7. |
| Q: What is the molecular weight of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: Molecular weight of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is 273.33. |
| Q: What is the SMILES notation of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: SMILES notation of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is CC(C)(C)OC(=O)N1CC(OC(C)(C)C)C1C(=O)O. |
| Q: What is the InChIKey of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: InChIKey of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is YKLNULGKYIWMBK-RKDXNWHRSA-N. |
| Q: What is the molecular formula of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid? |
| A: Molecular formula of (2R,3R)-3-(tert-butoxy)-1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid is C13H23NO5. |