Carbonyl-tryptophan
Modify Date: 2026-07-03 13:13:36
Carbonyl-tryptophan structure
|
Common Name | Carbonyl-tryptophan | ||
|---|---|---|---|---|
| CAS Number | 2648902-05-8 | Molecular Weight | 230.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbonyl-tryptophan |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O3 |
|---|---|
| Molecular Weight | 230.22 |
| InChIKey | CYJBMNKXCZKEEQ-NSHDSACASA-N |
| SMILES | O=C=NC(Cc1c[nH]c2ccccc12)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Carbonyl-tryptophan? |
| A: SMILES notation of Carbonyl-tryptophan is O=C=NC(Cc1c[nH]c2ccccc12)C(=O)O. |
| Q: What is the molecular weight of Carbonyl-tryptophan? |
| A: Molecular weight of Carbonyl-tryptophan is 230.22. |
| Q: What is the English name of Carbonyl-tryptophan? |
| A: The English name of Carbonyl-tryptophan is Carbonyl-tryptophan. |
| Q: What is the molecular formula of Carbonyl-tryptophan? |
| A: Molecular formula of Carbonyl-tryptophan is C12H10N2O3. |
| Q: What is the CAS number of Carbonyl-tryptophan? |
| A: CAS number of Carbonyl-tryptophan is 2648902-05-8. |
| Q: What is the Chinese name of 2648902-05-8? |
| A: Chinese name of 2648902-05-8 is 2648902-05-8. |
| Q: What is the InChIKey of Carbonyl-tryptophan? |
| A: InChIKey of Carbonyl-tryptophan is CYJBMNKXCZKEEQ-NSHDSACASA-N. |