Ethanone,1-(3-hydroxy-5-iodo-1H-indol-1-yl)- structure
|
Common Name | Ethanone,1-(3-hydroxy-5-iodo-1H-indol-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 26490-99-3 | Molecular Weight | 301.08000 | |
| Density | 1.89g/cm3 | Boiling Point | 408.9ºC at 760mmHg | |
| Molecular Formula | C10H8INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.1ºC | |
| Name | 1-(3-hydroxy-5-iodoindol-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760mmHg |
| Molecular Formula | C10H8INO2 |
| Molecular Weight | 301.08000 |
| Flash Point | 201.1ºC |
| Exact Mass | 300.96000 |
| PSA | 42.23000 |
| LogP | 2.61160 |
| Vapour Pressure | 2.85E-07mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | UVLGKRYWTYDENO-UHFFFAOYSA-N |
| SMILES | CC(=O)n1cc(O)c2cc(I)ccc21 |
|
~%
Ethanone,1-(3-h... CAS#:26490-99-3 |
| Literature: Holt et al. Journal of the Chemical Society, 1958 , p. 1217,1222 |
| 1-Acetyl-5-jod-indol-3-ol |
| 1-acetyl-5-iodo-indol-3-ol |
| 1-(3-hydroxy-5-iodo-1h-indol-1-yl)ethanone |
| 3-hydroxy-5-iodo-indole acetate |
| 5-Iod-1-acetylindol-3-ol |