3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran
Modify Date: 2026-08-27 17:28:56
3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran structure
|
Common Name | 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran | ||
|---|---|---|---|---|
| CAS Number | 2649034-76-2 | Molecular Weight | 179.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13NO2 |
|---|---|
| Molecular Weight | 179.22 |
| InChIKey | OCBRTFLYTMONCV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)N=C=O)c(C)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: SMILES notation of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is Cc1cc(C(C)(C)N=C=O)c(C)o1. |
| Q: What is the molecular formula of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: Molecular formula of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is C10H13NO2. |
| Q: What is the molecular weight of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: Molecular weight of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is 179.22. |
| Q: What is the English name of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: The English name of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran. |
| Q: What is the Chinese name of 2649034-76-2? |
| A: Chinese name of 2649034-76-2 is 2649034-76-2. |
| Q: What is the CAS number of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: CAS number of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is 2649034-76-2. |
| Q: What is the InChIKey of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran? |
| A: InChIKey of 3-(2-Isocyanatopropan-2-yl)-2,5-dimethylfuran is OCBRTFLYTMONCV-UHFFFAOYSA-N. |