7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine
Modify Date: 2026-07-08 11:19:01
7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine structure
|
Common Name | 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine | ||
|---|---|---|---|---|
| CAS Number | 2649061-90-3 | Molecular Weight | 221.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO4 |
|---|---|
| Molecular Weight | 221.21 |
| InChIKey | VZMJPLQKLATMHF-UHFFFAOYSA-N |
| SMILES | COc1cc(CN=C=O)cc2c1OCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: Molecular weight of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is 221.21. |
| Q: What is the CAS number of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: CAS number of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is 2649061-90-3. |
| Q: What is the InChIKey of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: InChIKey of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is VZMJPLQKLATMHF-UHFFFAOYSA-N. |
| Q: What is the English name of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: The English name of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine. |
| Q: What is the molecular formula of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: Molecular formula of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is C11H11NO4. |
| Q: What is the SMILES notation of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine? |
| A: SMILES notation of 7-(Isocyanatomethyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine is COc1cc(CN=C=O)cc2c1OCCO2. |
| Q: What is the Chinese name of 2649061-90-3? |
| A: Chinese name of 2649061-90-3 is 2649061-90-3. |