2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene
Modify Date: 2026-08-28 12:19:20
![2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene Structure](https://www.chemsrc.com/extcaspic/069/2649071-93-0.png)
2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene structure
|
Common Name | 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene | ||
|---|---|---|---|---|
| CAS Number | 2649071-93-0 | Molecular Weight | 205.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NOS |
|---|---|
| Molecular Weight | 205.28 |
| InChIKey | ZTXWDUIZUBSWPO-UHFFFAOYSA-N |
| SMILES | O=C=NC1(c2cc3c(s2)CCC3)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: Molecular formula of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is C11H11NOS. |
| Q: What is the SMILES notation of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: SMILES notation of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is O=C=NC1(c2cc3c(s2)CCC3)CC1. |
| Q: What is the Chinese name of 2649071-93-0? |
| A: Chinese name of 2649071-93-0 is 2649071-93-0. |
| Q: What is the InChIKey of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: InChIKey of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is ZTXWDUIZUBSWPO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: CAS number of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is 2649071-93-0. |
| Q: What is the molecular weight of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: Molecular weight of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is 205.28. |
| Q: What is the English name of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene? |
| A: The English name of 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene is 2-(1-isocyanatocyclopropyl)-4H,5H,6H-cyclopenta[b]thiophene. |