Thalidomide-O-C6-Br
Modify Date: 2026-08-16 17:20:48
Thalidomide-O-C6-Br structure
|
Common Name | Thalidomide-O-C6-Br | ||
|---|---|---|---|---|
| CAS Number | 2653338-53-3 | Molecular Weight | 437.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Thalidomide-O-C6-Br |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H21BrN2O5 |
|---|---|
| Molecular Weight | 437.3 |
| InChIKey | HGRAUYLIGAPRHU-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCCCCCCBr)c3C2=O)C(=O)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Thalidomide-O-C6-Br? |
| A: InChIKey of Thalidomide-O-C6-Br is HGRAUYLIGAPRHU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Thalidomide-O-C6-Br? |
| A: SMILES notation of Thalidomide-O-C6-Br is O=C1CCC(N2C(=O)c3cccc(OCCCCCCBr)c3C2=O)C(=O)N1. |
| Q: What is the molecular formula of Thalidomide-O-C6-Br? |
| A: Molecular formula of Thalidomide-O-C6-Br is C19H21BrN2O5. |
| Q: What is the CAS number of Thalidomide-O-C6-Br? |
| A: CAS number of Thalidomide-O-C6-Br is 2653338-53-3. |
| Q: What is the Chinese name of 2653338-53-3? |
| A: Chinese name of 2653338-53-3 is 2653338-53-3. |
| Q: What is the English name of Thalidomide-O-C6-Br? |
| A: The English name of Thalidomide-O-C6-Br is Thalidomide-O-C6-Br. |
| Q: What is the molecular weight of Thalidomide-O-C6-Br? |
| A: Molecular weight of Thalidomide-O-C6-Br is 437.3. |