(3,5-ditert-butylphenyl) N-methylcarbamate structure
|
Common Name | (3,5-ditert-butylphenyl) N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2655-19-8 | Molecular Weight | 263.37500 | |
| Density | 0.978g/cm3 | Boiling Point | 313.5ºC at 760mmHg | |
| Molecular Formula | C16H25NO2 | Melting Point | 97-99ºC | |
| MSDS | N/A | Flash Point | 143.4ºC | |
| Name | butacarb |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978g/cm3 |
|---|---|
| Boiling Point | 313.5ºC at 760mmHg |
| Melting Point | 97-99ºC |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37500 |
| Flash Point | 143.4ºC |
| Exact Mass | 263.18900 |
| PSA | 41.82000 |
| LogP | 4.20420 |
| Vapour Pressure | 0.000493mmHg at 25°C |
| Index of Refraction | 1.49 |
| InChIKey | SLZWBCGZQRRUNG-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butacarbe [French] |
| 3,5-di-tert-butylphenyl methylcarbamate |
| Caswell No. 291B |
| 3,5-di-t-butylphenyl-N-methyl carbamate |
| 3,5-Di-t-butylphenylmethylcarbamate |
| 3,5-Di-tert.-Butylphenyl-N-methylcarbamat |
| 3,5-bis(1,1-dimethylethyl)phenyl N-methylcarbamate |
| BUTACARB |
| 3,5-Di-tert-butylphenyl methylcarbamate |
| (3,5-ditert-butylphenyl) N-methylcarbamate |
| Butacarb [ISO:BSI] |