1-ethenylpyrrolidin-2-one,ethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | 1-ethenylpyrrolidin-2-one,ethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 26589-26-4 | Molecular Weight | 311.37300 | |
| Density | N/A | Boiling Point | 120.5ºC at 760mmHg | |
| Molecular Formula | C16H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 15.6ºC | |
| Name | 1-ethenylpyrrolidin-2-one,ethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 120.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.37300 |
| Flash Point | 15.6ºC |
| Exact Mass | 311.17300 |
| PSA | 83.91000 |
| LogP | 2.46290 |
| Vapour Pressure | 15.2mmHg at 25°C |
| InChIKey | SKZWEROLFVDCDG-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC.C=CN1CCCC1=O |
| Acrylates/PVP copolymer |
| Methacrylic acid,polymer with ethyl methacrylate and 1-vinyl-2-pyrrolidinone |
| Stepanhold extra |