Polyquaternium-7 structure
|
Common Name | Polyquaternium-7 | ||
|---|---|---|---|---|
| CAS Number | 26590-05-6 | Molecular Weight | 232.75000 | |
| Density | 1.02 (10% aq.) | Boiling Point | N/A | |
| Molecular Formula | C11H21ClN2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | >100℃ | |
| Name | N-Allyl-N,N-dimethyl-2-propen-1-aminium chloride-acrylamide (1: 1:1) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02 (10% aq.) |
|---|---|
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75000 |
| Flash Point | >100℃ |
| Exact Mass | 232.13400 |
| PSA | 46.91000 |
| LogP | 2.91670 |
| InChIKey | XFOSBZOUUACCCN-UHFFFAOYSA-M |
| SMILES | C=CC(N)=O.C=CC[N+](C)(C)CC=C.[Cl-] |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
Allergic contact dermatitis from laureth-9 and polyquaternium-7 in a skin-care product.
Contact Dermatitis 45(6) , 356-7, (2001)
|
| N,N-dimethyl-N-2-propenyl-2-propenaminium chloride |
| Methanimidamide,N'-(2-fluorophenyl)-N,N-dimethyl |
| MERQUAT.(R). 550L |
| polyquaternium 7 |
| MFCD00241413 |
| Poly(acrylamide-co-diallyldimethylammonium chloride) |
| N,N-Dimethyl-N'-2-fluorphenylformamidin |
| N'-(2-fluorophenyl)-N,N-dimethylformamidine |
| P(AAm-co-DADMAC) |
| 2-propenamide |
| Polyquaternium-7 |