N,N'-(methylenedi-4,1-phenylene)bis[3-oxobutyramide] structure
|
Common Name | N,N'-(methylenedi-4,1-phenylene)bis[3-oxobutyramide] | ||
|---|---|---|---|---|
| CAS Number | 26592-09-6 | Molecular Weight | 366.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-oxo-N-[4-[[4-(3-oxobutanoylamino)phenyl]methyl]phenyl]butanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H22N2O4 |
|---|---|
| Molecular Weight | 366.41000 |
| Exact Mass | 366.15800 |
| PSA | 92.34000 |
| LogP | 3.25860 |
| InChIKey | IKDBZGCSHHXRGV-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(Cc2ccc(NC(=O)CC(C)=O)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N,N'-(methylene... CAS#:26592-09-6 |
| Literature: Kaslow; Reck Journal of the American Chemical Society, 1947 , vol. 69, p. 864 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bis-(4-acetoacetylamino-phenyl)-methane |
| Acetoacetanilide,4',4'''-methylenebis-(8CI) |
| Butanamide,N,N'-(methylenedi-4,1-phenylene)bis[3-oxo |
| 3-oxo-N-(4-{[4-(3-oxobutanoylamino)phenyl]methyl}phenyl)butanamide |
| N,N'-(methylenedi-4,1-phenylene)bis[3-oxobutyramide] |