N-[(5-Methoxy-2-pyrimidinyl)carbamoyl]phosporamidic acid diphenyl ester
Modify Date: 2025-08-21 16:55:38
![N-[(5-Methoxy-2-pyrimidinyl)carbamoyl]phosporamidic acid diphenyl ester Structure](https://image.chemsrc.com/caspic/181/26594-08-1.png)
N-[(5-Methoxy-2-pyrimidinyl)carbamoyl]phosporamidic acid diphenyl ester structure
|
Common Name | N-[(5-Methoxy-2-pyrimidinyl)carbamoyl]phosporamidic acid diphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 26594-08-1 | Molecular Weight | 400.32500 | |
| Density | 1.398g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H17N4O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diphenoxyphosphoryl-3-(5-methoxypyrimidin-2-yl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.398g/cm3 |
|---|---|
| Molecular Formula | C18H17N4O5P |
| Molecular Weight | 400.32500 |
| Exact Mass | 400.09400 |
| PSA | 124.97000 |
| LogP | 4.27730 |
| Index of Refraction | 1.629 |
| InChIKey | WYPUAUSRHQQNMM-UHFFFAOYSA-N |
| SMILES | COc1cnc(NC(=O)NP(=O)(Oc2ccccc2)Oc2ccccc2)nc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| diphenyl[(5-methoxypyrimidin-2-yl)carbamoyl]phosphoramidate |
| Phosphoramidic acid,((5-methoxy-2-pyrimidinyl)carbamoyl)-,diphenyl ester |
| ((5-Methoxy-2-pyrimidinyl)carbamoyl)phosphoramidic acid diphenyl ester |
| (5-methoxy-pyrimidin-2-ylcarbamoyl)-phosphoramidic acid diphenyl ester |
| N-Diphenoxyphosphono-N'-5-methoxypyrimidyl-2-urea |