6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol structure
|
Common Name | 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol | ||
|---|---|---|---|---|
| CAS Number | 26638-56-2 | Molecular Weight | 275.32300 | |
| Density | 1.387g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.32300 |
| Flash Point | 229.1ºC |
| Exact Mass | 275.06200 |
| PSA | 65.99000 |
| LogP | 3.05260 |
| Vapour Pressure | 4.45E-09mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | UOFSLQBECAIORT-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2C(O)c2ccccc2S1(=O)=O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,11-Dihydro-10,10-dioxo-5-hydroxy-11-methyl-dibenzo-<c,f>-thiazepin |
| 6,11-dihydro-11-hydroxy-6-methyl-dibenzo<c,f><1,2>thiazepine S,S-dioxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: Molecular formula of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is C14H13NO3S. |
| Q: What English synonyms does 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol have? |
| A: English synonyms of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol: 5,11-Dihydro-10,10-dioxo-5-hydroxy-11-methyl-dibenzo--thiazepin, 6,11-dihydro-11-hydroxy-6-methyl-dibenzothiazepine S,S-dioxide. |
| Q: What is the SMILES notation of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: SMILES notation of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is CN1c2ccccc2C(O)c2ccccc2S1(=O)=O. |
| Q: What are the upstream materials of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: Related upstream materials(CAS) of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol: 26638-46-0. |
| Q: What is the LogP of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: LogP of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is 3.05260. |
| Q: What is the molecular weight of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: Molecular weight of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is 275.32300. |
| Q: What is the InChIKey of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: InChIKey of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is UOFSLQBECAIORT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 26638-56-2? |
| A: Chinese name of 26638-56-2 is 26638-56-2. |
| Q: What is the English name of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: The English name of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol. |
| Q: What is the polar surface area (PSA) of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol? |
| A: Polar surface area (PSA) of 6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-ol is 65.99000. |