3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl thiocyanate structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 26650-10-2 | Molecular Weight | 505.19400 | |
| Density | 1.627g/cm3 | Boiling Point | 251.682ºC at 760 mmHg | |
| Molecular Formula | C11H4F17NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.014ºC | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 251.682ºC at 760 mmHg |
| Molecular Formula | C11H4F17NS |
| Molecular Weight | 505.19400 |
| Flash Point | 106.014ºC |
| Exact Mass | 504.97900 |
| PSA | 49.09000 |
| LogP | 6.60018 |
| Vapour Pressure | 0.02mmHg at 25°C |
| Index of Refraction | 1.331 |
| InChIKey | QLKXZNKNUBWTFP-UHFFFAOYSA-N |
| SMILES | N#CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~88%
3,3,4,4,5,5,6,6... CAS#:26650-10-2 |
| Literature: Szonyi, F.; Cambon, A. Journal of Fluorine Chemistry, 1989 , vol. 42, p. 59 - 68 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Thiocyanic acid,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester |