7,11-dimethyldodeca-4,6,10-trien-3-one structure
|
Common Name | 7,11-dimethyldodeca-4,6,10-trien-3-one | ||
|---|---|---|---|---|
| CAS Number | 26651-96-7 | Molecular Weight | 206.32400 | |
| Density | 0.869g/cm3 | Boiling Point | 314.4ºC at 760 mmHg | |
| Molecular Formula | C14H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.1ºC | |
| Name | 7,11-dimethyldodeca-4,6,10-trien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.869g/cm3 |
|---|---|
| Boiling Point | 314.4ºC at 760 mmHg |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32400 |
| Flash Point | 138.1ºC |
| Exact Mass | 206.16700 |
| PSA | 17.07000 |
| LogP | 4.21440 |
| Vapour Pressure | 0.000466mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | SPHLZZZXIWUZNM-JPTKLRQTSA-N |
| SMILES | CCC(=O)C=CC=C(C)CCC=C(C)C |
| HS Code | 2914190090 |
|---|
|
~73%
7,11-dimethyldo... CAS#:26651-96-7 |
| Literature: Luzina; Tatarova; Korchagina; Salakhutdinov; Barkhash Russian Journal of Nondestructive Testing, 1997 , vol. 33, # 2 p. 183 - 193 |
|
~%
7,11-dimethyldo... CAS#:26651-96-7 |
| Literature: Fujiwara,K. et al. Bulletin of the Chemical Society of Japan, 1962 , vol. 35, p. 2042 - 2044 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914190090 |
|---|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,6,10-Dodecatrien-3-one,7,11-dimethyl |
| 7,11-dimethyl-4,6-10-dodecatrien-3-one |
| methylpseudoionone |
| Pseudomethylionone |
| EINECS 247-878-3 |
| 2,6-Dimethyldodeca-2,6,8-trien-10-one |
| Pseudo methyl ionones |
| 7,11-dimethyl-dodeca-4,6,10-trien-3-one |
| n-methyl-pseudoionone |