H-Phe-Phe-Phe-Phe-OH structure
|
Common Name | H-Phe-Phe-Phe-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 2667-02-9 | Molecular Weight | 606.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H38N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Phe-Phe-Phe-Phe-OHH-Phe-Phe-Phe-Phe-OH is a tetrapeptide that can generate vertically aligned, highly ordered 3-D bionanostructures[1]. |
| Name | acetic acid,2-[[2-[[2-[(2-amino-3-phenylpropanoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Phe-Phe-Phe-Phe-OH is a tetrapeptide that can generate vertically aligned, highly ordered 3-D bionanostructures[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H38N4O5 |
|---|---|
| Molecular Weight | 606.71 |
| Exact Mass | 666.30500 |
| PSA | 198.39000 |
| LogP | 6.13560 |
| InChIKey | NJNPEPZWJBIJCK-YDPTYEFTSA-N |
| SMILES | NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| WGK Germany | 3 |
|---|
| Phe-Phe-Phe-Phe-acetate salt |
| PHE-PHE-PHE-PHE |
| Tetra(phenylalanine) |
| H-Phe-Phe-Phe-Phe-OH |
| Alanine,3-phenyl-N-[3-phenyl-N-[3-phenyl-N-(3-phenyl-L-alanyl)-L-alanyl]-L-alanyl]-,L-(8CI) |
| Tetra-L-phenylalanine |
| L-Phenylalanine,N-[N-(N-L-phenylalanyl-L-phenylalanyl)-L-phenylalanyl] |
| Alanine,3-phenyl-N-[3-phenyl-N-[3-phenyl-N-(3-phenyl-L-alanyl)-L-alanyl]-L-alanyl]-(7CI) |