1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide structure
|
Common Name | 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 26675-52-5 | Molecular Weight | 293.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|
| Molecular Formula | C18H15NO3 |
|---|---|
| Molecular Weight | 293.3 |
| InChIKey | FOXHGFAYNSVJSF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)C2=C(C3=CC=CC=C3C=C2)O |
|
Name: Lipophilicity, log K of the compound by RP-HPLC analysis
Source: ChEMBL
Target: N/A
External Id: CHEMBL2447061
|
|
Name: Inhibition of PS2 in spinach chloroplasts assessed as photoreduction of DCPIP measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2446807
|
|
Name: Inhibition of PS2 in spinach chloroplasts assessed as photoreduction of DCPIP measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2446806
|