1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide
Modify Date: 2026-06-22 20:37:27
1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide structure
|
Common Name | 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 26675-52-5 | Molecular Weight | 293.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H15NO3 |
|---|---|
| Molecular Weight | 293.3 |
| InChIKey | FOXHGFAYNSVJSF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)C2=C(C3=CC=CC=C3C=C2)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Lipophilicity, log K of the compound by RP-HPLC analysis
Source: ChEMBL
Target: N/A
External Id: CHEMBL2447061
|
|
Name: Inhibition of PS2 in spinach chloroplasts assessed as photoreduction of DCPIP measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2446807
|
|
Name: Inhibition of PS2 in spinach chloroplasts assessed as photoreduction of DCPIP measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2446806
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: InChIKey of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is FOXHGFAYNSVJSF-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: CAS number of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is 26675-52-5. |
| Q: What is the Chinese name of 26675-52-5? |
| A: Chinese name of 26675-52-5 is 26675-52-5. |
| Q: What is the SMILES notation of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: SMILES notation of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is COC1=CC=CC=C1NC(=O)C2=C(C3=CC=CC=C3C=C2)O. |
| Q: What is the English name of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: The English name of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide. |
| Q: What is the molecular weight of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: Molecular weight of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is 293.3. |
| Q: What is the molecular formula of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide? |
| A: Molecular formula of 1-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide is C18H15NO3. |